C17H28N3O3+ — CID 8907070
[2-(2-ethoxyanilino)-2-oxoethyl]-ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium (PubChem CID 8907070) has the molecular formula C17H28N3O3+ and a molecular weight of 322.43 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl]-ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl]-ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8907070 |
| Molecular Formula | C17H28N3O3+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl]-ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
| SMILES | CCOc1ccccc1NC(=O)C[NH+](CC)CC(=O)NC(C)C |
| InChI | InChI=1S/C17H27N3O3/c1-5-20(11-16(21)18-13(3)4)12-17(22)19-14-9-7-8-10-15(14)23-6-2/h7-10,13H,5-6,11-12H2,1-4H3,(H,18,21)(H,19,22)/p+1 |
| InChIKey | GBDZBIVYFHAOPK-UHFFFAOYSA-O |
| XLogP | 0.45 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |