C18H19N2OS+ — CID 9054362
methyl-[2-(naphthalen-2-ylamino)-2-oxoethyl]-(thiophen-3-ylmethyl)azanium (PubChem CID 9054362) has the molecular formula C18H19N2OS+ and a molecular weight of 311.43 g/mol. Its IUPAC name is methyl-[2-(naphthalen-2-ylamino)-2-oxoethyl]-(thiophen-3-ylmethyl)azanium.
| Compound Name | methyl-[2-(naphthalen-2-ylamino)-2-oxoethyl]-(thiophen-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 9054362 |
| Molecular Formula | C18H19N2OS+ |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | methyl-[2-(naphthalen-2-ylamino)-2-oxoethyl]-(thiophen-3-ylmethyl)azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc2ccccc2c1)Cc1ccsc1 |
| InChI | InChI=1S/C18H18N2OS/c1-20(11-14-8-9-22-13-14)12-18(21)19-17-7-6-15-4-2-3-5-16(15)10-17/h2-10,13H,11-12H2,1H3,(H,19,21)/p+1 |
| InChIKey | RMNZGNNZAIKLSX-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |