C19H28N3O3S2+ — CID 8925854
[2-[4-[butyl(methyl)sulfamoyl]anilino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium (PubChem CID 8925854) has the molecular formula C19H28N3O3S2+ and a molecular weight of 410.59 g/mol. Its IUPAC name is [2-[4-[butyl(methyl)sulfamoyl]anilino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium.
| Compound Name | [2-[4-[butyl(methyl)sulfamoyl]anilino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 8925854 |
| Molecular Formula | C19H28N3O3S2+ |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [2-[4-[butyl(methyl)sulfamoyl]anilino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(NC(=O)C[NH+](C)Cc2ccsc2)cc1 |
| InChI | InChI=1S/C19H27N3O3S2/c1-4-5-11-22(3)27(24,25)18-8-6-17(7-9-18)20-19(23)14-21(2)13-16-10-12-26-15-16/h6-10,12,15H,4-5,11,13-14H2,1-3H3,(H,20,23)/p+1 |
| InChIKey | IWFXPEODUFRMFP-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |