C19H23F2N3O3S — CID 24616559
2-[4-[butyl(methyl)sulfamoyl]anilino]-N-(2,6-difluorophenyl)acetamide (PubChem CID 24616559) has the molecular formula C19H23F2N3O3S and a molecular weight of 411.47 g/mol. Its IUPAC name is 2-[4-[butyl(methyl)sulfamoyl]anilino]-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-[4-[butyl(methyl)sulfamoyl]anilino]-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 24616559 |
| Molecular Formula | C19H23F2N3O3S |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-[4-[butyl(methyl)sulfamoyl]anilino]-N-(2,6-difluorophenyl)acetamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(NCC(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C19H23F2N3O3S/c1-3-4-12-24(2)28(26,27)15-10-8-14(9-11-15)22-13-18(25)23-19-16(20)6-5-7-17(19)21/h5-11,22H,3-4,12-13H2,1-2H3,(H,23,25) |
| InChIKey | OJKJGSZNSYTRRI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |