C16H19BrN3O3S+ — CID 9054688
[2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium (PubChem CID 9054688) has the molecular formula C16H19BrN3O3S+ and a molecular weight of 413.32 g/mol. Its IUPAC name is [2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium.
| Compound Name | [2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 9054688 |
| Molecular Formula | C16H19BrN3O3S+ |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | [2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
| SMILES | C[NH+](CC(=O)NNC(=O)COc1ccc(Br)cc1)Cc1ccsc1 |
| InChI | InChI=1S/C16H18BrN3O3S/c1-20(8-12-6-7-24-11-12)9-15(21)18-19-16(22)10-23-14-4-2-13(17)3-5-14/h2-7,11H,8-10H2,1H3,(H,18,21)(H,19,22)/p+1 |
| InChIKey | PTUNSKQTMZVTCS-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|