C14H20BrN3O3 — CID 78807447
N'-[2-(4-bromophenoxy)acetyl]-2-(diethylamino)acetohydrazide (PubChem CID 78807447) has the molecular formula C14H20BrN3O3 and a molecular weight of 358.24 g/mol. Its IUPAC name is N'-[2-(4-bromophenoxy)acetyl]-2-(diethylamino)acetohydrazide.
| Compound Name | N'-[2-(4-bromophenoxy)acetyl]-2-(diethylamino)acetohydrazide |
|---|---|
| PubChem CID | 78807447 |
| Molecular Formula | C14H20BrN3O3 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | N'-[2-(4-bromophenoxy)acetyl]-2-(diethylamino)acetohydrazide |
| SMILES | CCN(CC)CC(=O)NNC(=O)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrN3O3/c1-3-18(4-2)9-13(19)16-17-14(20)10-21-12-7-5-11(15)6-8-12/h5-8H,3-4,9-10H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | ZWSULIPSLLYBJQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|