C16H24BrN4O4+ — CID 8710940
[2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-ethyl-[2-(ethylamino)-2-oxoethyl]azanium (PubChem CID 8710940) has the molecular formula C16H24BrN4O4+ and a molecular weight of 416.30 g/mol. Its IUPAC name is [2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-ethyl-[2-(ethylamino)-2-oxoethyl]azanium.
| Compound Name | [2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-ethyl-[2-(ethylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8710940 |
| Molecular Formula | C16H24BrN4O4+ |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-ethyl-[2-(ethylamino)-2-oxoethyl]azanium |
| SMILES | CCNC(=O)C[NH+](CC)CC(=O)NNC(=O)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H23BrN4O4/c1-3-18-14(22)9-21(4-2)10-15(23)19-20-16(24)11-25-13-7-5-12(17)6-8-13/h5-8H,3-4,9-11H2,1-2H3,(H,18,22)(H,19,23)(H,20,24)/p+1 |
| InChIKey | FQTNGBIHARNDSA-UHFFFAOYSA-O |
| XLogP | -0.98 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|