C18H25N2O3S+ — CID 8925963
[2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium (PubChem CID 8925963) has the molecular formula C18H25N2O3S+ and a molecular weight of 349.48 g/mol. Its IUPAC name is [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium.
| Compound Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 8925963 |
| Molecular Formula | C18H25N2O3S+ |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
| SMILES | CCOc1ccc(OCCNC(=O)C[NH+](C)Cc2ccsc2)cc1 |
| InChI | InChI=1S/C18H24N2O3S/c1-3-22-16-4-6-17(7-5-16)23-10-9-19-18(21)13-20(2)12-15-8-11-24-14-15/h4-8,11,14H,3,9-10,12-13H2,1-2H3,(H,19,21)/p+1 |
| InChIKey | GZKKXHUODNINMO-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|