C24H34N3O3+ — CID 9125919
[2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl]-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium (PubChem CID 9125919) has the molecular formula C24H34N3O3+ and a molecular weight of 412.55 g/mol. Its IUPAC name is [2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl]-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium.
| Compound Name | [2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl]-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9125919 |
| Molecular Formula | C24H34N3O3+ |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl]-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium |
| SMILES | CNC(=O)c1ccc(C[NH+](C)CC(=O)NCCOc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H33N3O3/c1-24(2,3)20-10-12-21(13-11-20)30-15-14-26-22(28)17-27(5)16-18-6-8-19(9-7-18)23(29)25-4/h6-13H,14-17H2,1-5H3,(H,25,29)(H,26,28)/p+1 |
| InChIKey | GOEGGXLYIFIZBG-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|