C17H21F3N2O4 — CID 47059248
4-morpholin-4-yl-4-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide (PubChem CID 47059248) has the molecular formula C17H21F3N2O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is 4-morpholin-4-yl-4-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide.
| Compound Name | 4-morpholin-4-yl-4-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 47059248 |
| Molecular Formula | C17H21F3N2O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-morpholin-4-yl-4-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide |
| SMILES | O=C(CCC(=O)N1CCOCC1)NCCOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H21F3N2O4/c18-17(19,20)13-1-3-14(4-2-13)26-10-7-21-15(23)5-6-16(24)22-8-11-25-12-9-22/h1-4H,5-12H2,(H,21,23) |
| InChIKey | OEIQBHMFXXRQMU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|