C21H20F3NO5 — CID 55969709
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide (PubChem CID 55969709) has the molecular formula C21H20F3NO5 and a molecular weight of 423.39 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 55969709 |
| Molecular Formula | C21H20F3NO5 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)OCCO2)NCCOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F3NO5/c22-21(23,24)15-2-4-16(5-3-15)28-10-9-25-20(27)8-6-17(26)14-1-7-18-19(13-14)30-12-11-29-18/h1-5,7,13H,6,8-12H2,(H,25,27) |
| InChIKey | KQMLJBPFDMZUCS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|