C14H17F3N2O3 — CID 71911048
1-(oxolan-3-yl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]urea (PubChem CID 71911048) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.29 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]urea.
| Compound Name | 1-(oxolan-3-yl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]urea |
|---|---|
| PubChem CID | 71911048 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(oxolan-3-yl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]urea |
| SMILES | O=C(NCCOc1ccc(C(F)(F)F)cc1)NC1CCOC1 |
| InChI | InChI=1S/C14H17F3N2O3/c15-14(16,17)10-1-3-12(4-2-10)22-8-6-18-13(20)19-11-5-7-21-9-11/h1-4,11H,5-9H2,(H2,18,19,20) |
| InChIKey | HWRBWQDMRXFJCI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|