C18H20FN4O4+ — CID 9253471
[2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]azanium (PubChem CID 9253471) has the molecular formula C18H20FN4O4+ and a molecular weight of 375.38 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9253471 |
| Molecular Formula | C18H20FN4O4+ |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]azanium |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C[NH+](C)CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN4O4/c1-12-9-15(23(26)27)7-8-16(12)21-18(25)11-22(2)10-17(24)20-14-5-3-13(19)4-6-14/h3-9H,10-11H2,1-2H3,(H,20,24)(H,21,25)/p+1 |
| InChIKey | PEPKUMOCVFPCAE-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|