C20H19FN2O4 — CID 108982356
ethyl 2-[[1-[(2-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate (PubChem CID 108982356) has the molecular formula C20H19FN2O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is ethyl 2-[[1-[(2-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[1-[(2-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 108982356 |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | ethyl 2-[[1-[(2-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C1(C(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H19FN2O4/c1-2-27-17(24)13-7-3-5-9-15(13)22-18(25)20(11-12-20)19(26)23-16-10-6-4-8-14(16)21/h3-10H,2,11-12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | CZQUMCPOLYJXMQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|