C19H18FNO3 — CID 110428357
ethyl 2-[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]benzoate (PubChem CID 110428357) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is ethyl 2-[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 110428357 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | ethyl 2-[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C1(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H18FNO3/c1-2-24-17(22)13-7-3-6-10-16(13)21-18(23)19(11-12-19)14-8-4-5-9-15(14)20/h3-10H,2,11-12H2,1H3,(H,21,23) |
| InChIKey | OJBMEPGWGKLJOD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |