C22H28N2O7S — CID 55314759
[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 55314759) has the molecular formula C22H28N2O7S and a molecular weight of 464.54 g/mol. Its IUPAC name is [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 55314759 |
| Molecular Formula | C22H28N2O7S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)COC(=O)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H28N2O7S/c1-5-24(6-2)32(27,28)18-10-8-17(9-11-18)23-21(25)15-31-22(26)14-16-7-12-19(29-3)20(13-16)30-4/h7-13H,5-6,14-15H2,1-4H3,(H,23,25) |
| InChIKey | YWSBAWYVTSAYMW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |