C22H31N3O6S2 — CID 100678955
N-[4-(diethylsulfamoyl)phenyl]-3-[5-(dimethylsulfamoyl)-2-methoxyphenyl]propanamide (PubChem CID 100678955) has the molecular formula C22H31N3O6S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-3-[5-(dimethylsulfamoyl)-2-methoxyphenyl]propanamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-3-[5-(dimethylsulfamoyl)-2-methoxyphenyl]propanamide |
|---|---|
| PubChem CID | 100678955 |
| Molecular Formula | C22H31N3O6S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-3-[5-(dimethylsulfamoyl)-2-methoxyphenyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CCc2cc(S(=O)(=O)N(C)C)ccc2OC)cc1 |
| InChI | InChI=1S/C22H31N3O6S2/c1-6-25(7-2)33(29,30)19-11-9-18(10-12-19)23-22(26)15-8-17-16-20(13-14-21(17)31-5)32(27,28)24(3)4/h9-14,16H,6-8,15H2,1-5H3,(H,23,26) |
| InChIKey | DJVRJQXARWQCQS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |