C22H26N2O5 — CID 7984519
butyl 4-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethoxy]benzoate (PubChem CID 7984519) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is butyl 4-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethoxy]benzoate.
| Compound Name | butyl 4-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 7984519 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | butyl 4-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethoxy]benzoate |
| SMILES | CCCCOC(=O)c1ccc(OCC(=O)Nc2ccc(C(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-4-5-14-28-22(27)17-8-12-19(13-9-17)29-15-20(25)23-18-10-6-16(7-11-18)21(26)24(2)3/h6-13H,4-5,14-15H2,1-3H3,(H,23,25) |
| InChIKey | SLNHLYAHGOSLGH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|