C18H18N4O8 — CID 16796855
[2-(2-methyl-3-nitroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate (PubChem CID 16796855) has the molecular formula C18H18N4O8 and a molecular weight of 418.36 g/mol. Its IUPAC name is [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate.
| Compound Name | [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 16796855 |
| Molecular Formula | C18H18N4O8 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
| SMILES | Cc1c(NC(=O)COC(=O)c2cc([N+](=O)[O-])ccc2NCCO)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N4O8/c1-11-14(3-2-4-16(11)22(28)29)20-17(24)10-30-18(25)13-9-12(21(26)27)5-6-15(13)19-7-8-23/h2-6,9,19,23H,7-8,10H2,1H3,(H,20,24) |
| InChIKey | DMYXKZYHDLXXQS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|