C13H12F2N6O2 — CID 169344830
3-[4-(difluoromethoxy)-3-ethoxyanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169344830) has the molecular formula C13H12F2N6O2 and a molecular weight of 322.28 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-ethoxyanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-(difluoromethoxy)-3-ethoxyanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169344830 |
| Molecular Formula | C13H12F2N6O2 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-ethoxyanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CCOc1cc(NC=C(C#N)c2nn[nH]n2)ccc1OC(F)F |
| InChI | InChI=1S/C13H12F2N6O2/c1-2-22-11-5-9(3-4-10(11)23-13(14)15)17-7-8(6-16)12-18-20-21-19-12/h3-5,7,13,17H,2H2,1H3,(H,18,19,20,21) |
| InChIKey | MCLTUMKCXGYTHR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|