C18H14N8 — CID 169343910
3-[4-(2-methylbenzimidazol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343910) has the molecular formula C18H14N8 and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-[4-(2-methylbenzimidazol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-(2-methylbenzimidazol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343910 |
| Molecular Formula | C18H14N8 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-[4-(2-methylbenzimidazol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1nc2ccccc2n1-c1ccc(NC=C(C#N)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C18H14N8/c1-12-21-16-4-2-3-5-17(16)26(12)15-8-6-14(7-9-15)20-11-13(10-19)18-22-24-25-23-18/h2-9,11,20H,1H3,(H,22,23,24,25) |
| InChIKey | ITFBSNBRKGKFIF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|