C15H14N6O4 — CID 169346515
2-[[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]methyl]butanedioic acid (PubChem CID 169346515) has the molecular formula C15H14N6O4 and a molecular weight of 342.32 g/mol. Its IUPAC name is 2-[[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]methyl]butanedioic acid.
| Compound Name | 2-[[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]methyl]butanedioic acid |
|---|---|
| PubChem CID | 169346515 |
| Molecular Formula | C15H14N6O4 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-[[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]methyl]butanedioic acid |
| SMILES | N#CC(=CNc1ccc(CC(CC(=O)O)C(=O)O)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H14N6O4/c16-7-11(14-18-20-21-19-14)8-17-12-3-1-9(2-4-12)5-10(15(24)25)6-13(22)23/h1-4,8,10,17H,5-6H2,(H,22,23)(H,24,25)(H,18,19,20,21) |
| InChIKey | XQRCQJHMBOPPNP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 164.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|