C18H17N7O2 — CID 169345517
3-[(2-cyclohexyl-1,3-dioxoisoindol-4-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345517) has the molecular formula C18H17N7O2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 3-[(2-cyclohexyl-1,3-dioxoisoindol-4-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(2-cyclohexyl-1,3-dioxoisoindol-4-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345517 |
| Molecular Formula | C18H17N7O2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 3-[(2-cyclohexyl-1,3-dioxoisoindol-4-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cccc2c1C(=O)N(C1CCCCC1)C2=O)c1nn[nH]n1 |
| InChI | InChI=1S/C18H17N7O2/c19-9-11(16-21-23-24-22-16)10-20-14-8-4-7-13-15(14)18(27)25(17(13)26)12-5-2-1-3-6-12/h4,7-8,10,12,20H,1-3,5-6H2,(H,21,22,23,24) |
| InChIKey | YUSMQOCEPNPEGW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|