C13H8F3N9 — CID 169346124
2-(2H-tetrazol-5-yl)-3-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)anilino]prop-2-enenitrile (PubChem CID 169346124) has the molecular formula C13H8F3N9 and a molecular weight of 347.26 g/mol. Its IUPAC name is 2-(2H-tetrazol-5-yl)-3-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)anilino]prop-2-enenitrile.
| Compound Name | 2-(2H-tetrazol-5-yl)-3-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 169346124 |
| Molecular Formula | C13H8F3N9 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-(2H-tetrazol-5-yl)-3-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)anilino]prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(C(F)(F)F)ccc1-n1cncn1)c1nn[nH]n1 |
| InChI | InChI=1S/C13H8F3N9/c14-13(15,16)9-1-2-11(25-7-18-6-20-25)10(3-9)19-5-8(4-17)12-21-23-24-22-12/h1-3,5-7,19H,(H,21,22,23,24) |
| InChIKey | BHPYOKVEUJVGGJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|