C16H10N6O3 — CID 2798206
N-[6-(2,2-dicyanoethenylamino)-2-pyridinyl]-4-nitrobenzamide (PubChem CID 2798206) has the molecular formula C16H10N6O3 and a molecular weight of 334.30 g/mol. Its IUPAC name is N-[6-(2,2-dicyanoethenylamino)-2-pyridinyl]-4-nitrobenzamide.
| Compound Name | N-[6-(2,2-dicyanoethenylamino)-2-pyridinyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 2798206 |
| Molecular Formula | C16H10N6O3 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[6-(2,2-dicyanoethenylamino)-2-pyridinyl]-4-nitrobenzamide |
| SMILES | N#CC(C#N)=CNc1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C16H10N6O3/c17-8-11(9-18)10-19-14-2-1-3-15(20-14)21-16(23)12-4-6-13(7-5-12)22(24)25/h1-7,10H,(H2,19,20,21,23) |
| InChIKey | BWNBWBZMQVOKEJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|