C23H13BrN4O7 — CID 3134697
[4-[3-(2-bromo-4-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 2-nitrobenzoate (PubChem CID 3134697) has the molecular formula C23H13BrN4O7 and a molecular weight of 537.28 g/mol. Its IUPAC name is [4-[3-(2-bromo-4-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 2-nitrobenzoate.
| Compound Name | [4-[3-(2-bromo-4-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 3134697 |
| Molecular Formula | C23H13BrN4O7 |
| Molecular Weight | 537.28 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | [4-[3-(2-bromo-4-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 2-nitrobenzoate |
| SMILES | N#CC(=Cc1ccc(OC(=O)c2ccccc2[N+](=O)[O-])cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C23H13BrN4O7/c24-19-12-16(27(31)32)7-10-20(19)26-22(29)15(13-25)11-14-5-8-17(9-6-14)35-23(30)18-3-1-2-4-21(18)28(33)34/h1-12H,(H,26,29) |
| InChIKey | TXAFYMSVWPVMPG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 165.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|