C23H19NO6 — CID 7133669
[2-(4-methoxycarbonylanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate (PubChem CID 7133669) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is [2-(4-methoxycarbonylanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate.
| Compound Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 7133669 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)c2ccc(-c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H19NO6/c1-29-22(27)17-6-10-19(11-7-17)24-21(26)14-30-23(28)18-4-2-15(3-5-18)16-8-12-20(25)13-9-16/h2-13,25H,14H2,1H3,(H,24,26) |
| InChIKey | AUSTXVPAIBZJDQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |