C21H20N2O5 — CID 2484664
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-methylquinoline-4-carboxylate (PubChem CID 2484664) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-methylquinoline-4-carboxylate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2484664 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-methylquinoline-4-carboxylate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cc(C)nc3ccccc23)cc(OC)c1 |
| InChI | InChI=1S/C21H20N2O5/c1-13-8-18(17-6-4-5-7-19(17)22-13)21(25)28-12-20(24)23-14-9-15(26-2)11-16(10-14)27-3/h4-11H,12H2,1-3H3,(H,23,24) |
| InChIKey | VYBBFANNTRALOP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |