C13H15N3O6 — CID 3899797
bis[2-(methylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate (PubChem CID 3899797) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is bis[2-(methylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[2-(methylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 3899797 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | bis[2-(methylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate |
| SMILES | CNC(=O)COC(=O)c1cccc(C(=O)OCC(=O)NC)n1 |
| InChI | InChI=1S/C13H15N3O6/c1-14-10(17)6-21-12(19)8-4-3-5-9(16-8)13(20)22-7-11(18)15-2/h3-5H,6-7H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | KRBRZJWPFLWKSE-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |