C24H27FN2O5 — CID 42970641
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoate (PubChem CID 42970641) has the molecular formula C24H27FN2O5 and a molecular weight of 442.49 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 42970641 |
| Molecular Formula | C24H27FN2O5 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoate |
| SMILES | CC1CCC(NC(=O)COC(=O)c2ccccc2OCC(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C24H27FN2O5/c1-16-10-12-17(13-11-16)26-22(28)15-32-24(30)18-6-2-5-9-21(18)31-14-23(29)27-20-8-4-3-7-19(20)25/h2-9,16-17H,10-15H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | IUEXWFRTAUDINU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |