C22H17FN2O6S — CID 43023216
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoate (PubChem CID 43023216) has the molecular formula C22H17FN2O6S and a molecular weight of 456.45 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 43023216 |
| Molecular Formula | C22H17FN2O6S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1OCC(=O)Nc1ccccc1F)NC(=O)c1cccs1 |
| InChI | InChI=1S/C22H17FN2O6S/c23-15-7-2-3-8-16(15)24-19(26)12-30-17-9-4-1-6-14(17)22(29)31-13-20(27)25-21(28)18-10-5-11-32-18/h1-11H,12-13H2,(H,24,26)(H,25,27,28) |
| InChIKey | JXZBTAYMIQEYCN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |