C23H27NO3 — CID 7809504
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-benzylbenzoate (PubChem CID 7809504) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-benzylbenzoate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-benzylbenzoate |
|---|---|
| PubChem CID | 7809504 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-benzylbenzoate |
| SMILES | CC1CCC(NC(=O)COC(=O)c2ccccc2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27NO3/c1-17-11-13-20(14-12-17)24-22(25)16-27-23(26)21-10-6-5-9-19(21)15-18-7-3-2-4-8-18/h2-10,17,20H,11-16H2,1H3,(H,24,25) |
| InChIKey | XFWHRQSDGJMKAO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |