C20H19NO8 — CID 7834162
dimethyl 2-[[2-[(2S)-2-hydroxy-2-phenylacetyl]oxyacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 7834162) has the molecular formula C20H19NO8 and a molecular weight of 401.37 g/mol. Its IUPAC name is dimethyl 2-[[2-[(2S)-2-hydroxy-2-phenylacetyl]oxyacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-[(2S)-2-hydroxy-2-phenylacetyl]oxyacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 7834162 |
| Molecular Formula | C20H19NO8 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | dimethyl 2-[[2-[(2S)-2-hydroxy-2-phenylacetyl]oxyacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COC(=O)[C@@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H19NO8/c1-27-18(24)13-8-9-14(19(25)28-2)15(10-13)21-16(22)11-29-20(26)17(23)12-6-4-3-5-7-12/h3-10,17,23H,11H2,1-2H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | PTTKLOATWZVAEH-KRWDZBQOSA-N |
| XLogP | 1.48 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|