C26H24N2O8S — CID 4248824
dimethyl 2-[[2-[3-phenyl-2-(thiophene-2-carbonylamino)propanoyl]oxyacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 4248824) has the molecular formula C26H24N2O8S and a molecular weight of 524.55 g/mol. Its IUPAC name is dimethyl 2-[[2-[3-phenyl-2-(thiophene-2-carbonylamino)propanoyl]oxyacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-[3-phenyl-2-(thiophene-2-carbonylamino)propanoyl]oxyacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 4248824 |
| Molecular Formula | C26H24N2O8S |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | dimethyl 2-[[2-[3-phenyl-2-(thiophene-2-carbonylamino)propanoyl]oxyacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COC(=O)C(Cc2ccccc2)NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C26H24N2O8S/c1-34-24(31)17-10-11-18(25(32)35-2)19(14-17)27-22(29)15-36-26(33)20(13-16-7-4-3-5-8-16)28-23(30)21-9-6-12-37-21/h3-12,14,20H,13,15H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | TXWCVWWYNRTVCQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|