methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate

C19H21NO3 — CID 9439805

IUPACmethyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate
SMILESCOC(=O)c1ccc(C)c(NC(=O)c2c(C)cc(C)cc2C)c1
InChIInChI=1S/C19H21NO3/c1-11-8-13(3)17(14(4)9-11)18(21)20-16-10-15(19(22)23-5)7-6-12(16)2/h6-10H,1-5H3,(H,20,21)
InChIKeyFBNALCPYAWPKAP-UHFFFAOYSA-N
MW311.38 g/mol
LogP3.96
Rot. Bonds3

About methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate

methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate (PubChem CID 9439805) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate.

Molecular Properties

Compound Namemethyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate
PubChem CID9439805
Molecular FormulaC19H21NO3
Molecular Weight311.38 g/mol
Exact Mass311.15
IUPAC Namemethyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate
SMILESCOC(=O)c1ccc(C)c(NC(=O)c2c(C)cc(C)cc2C)c1
InChIInChI=1S/C19H21NO3/c1-11-8-13(3)17(14(4)9-11)18(21)20-16-10-15(19(22)23-5)7-6-12(16)2/h6-10H,1-5H3,(H,20,21)
InChIKeyFBNALCPYAWPKAP-UHFFFAOYSA-N
XLogP3.96
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.38
LogP ≤ 53.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate?
The IUPAC name of methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate (CID 9439805) is methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate.
What is the SMILES notation for methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate?
The canonical SMILES for methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate is COC(=O)c1ccc(C)c(NC(=O)c2c(C)cc(C)cc2C)c1.
What is the InChIKey of methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate?
The InChIKey is FBNALCPYAWPKAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3/c1-11-8-13(3)17(14(4)9-11)18(21)20-16-10-15(19(22)23-5)7-6-12(16)2/h6-10H,1-5H3,(H,20,21).
What are the key properties of methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate?
methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate has a molecular weight of 311.38 g/mol, XLogP of 3.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-3-[(2,4,6-trimethylbenzoyl)amino]benzoate is sourced from PubChem (CID 9439805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).