C21H20N2O4 — CID 78772300
3-pyridin-4-ylpropyl 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 78772300) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | 3-pyridin-4-ylpropyl 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 78772300 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 3-pyridin-4-ylpropyl 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCCc2ccncc2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H20N2O4/c1-15-6-7-17(14-18(15)23-20(24)19-5-3-12-26-19)21(25)27-13-2-4-16-8-10-22-11-9-16/h3,5-12,14H,2,4,13H2,1H3,(H,23,24) |
| InChIKey | WSCIWGXENFFSQJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|