C24H16F3NO3 — CID 16761301
N-[2-(4-phenylphenoxy)-5-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 16761301) has the molecular formula C24H16F3NO3 and a molecular weight of 423.39 g/mol. Its IUPAC name is N-[2-(4-phenylphenoxy)-5-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[2-(4-phenylphenoxy)-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 16761301 |
| Molecular Formula | C24H16F3NO3 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[2-(4-phenylphenoxy)-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Oc1ccc(-c2ccccc2)cc1)c1ccco1 |
| InChI | InChI=1S/C24H16F3NO3/c25-24(26,27)18-10-13-21(20(15-18)28-23(29)22-7-4-14-30-22)31-19-11-8-17(9-12-19)16-5-2-1-3-6-16/h1-15H,(H,28,29) |
| InChIKey | FKBGJYRLLHOPDW-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |