C25H18F3NO3 — CID 132814466
N-[2-(2-benzylphenoxy)-5-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 132814466) has the molecular formula C25H18F3NO3 and a molecular weight of 437.42 g/mol. Its IUPAC name is N-[2-(2-benzylphenoxy)-5-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[2-(2-benzylphenoxy)-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 132814466 |
| Molecular Formula | C25H18F3NO3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-[2-(2-benzylphenoxy)-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Oc1ccccc1Cc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C25H18F3NO3/c26-25(27,28)19-12-13-22(20(16-19)29-24(30)23-11-6-14-31-23)32-21-10-5-4-9-18(21)15-17-7-2-1-3-8-17/h1-14,16H,15H2,(H,29,30) |
| InChIKey | SPCRTCRENDJLGA-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |