C12H10F3N3O2S — CID 10267859
N-[2-(methylsulfanylamino)-5-(trifluoromethyl)-3-pyridinyl]furan-2-carboxamide (PubChem CID 10267859) has the molecular formula C12H10F3N3O2S and a molecular weight of 317.29 g/mol. Its IUPAC name is N-[2-(methylsulfanylamino)-5-(trifluoromethyl)-3-pyridinyl]furan-2-carboxamide.
| Compound Name | N-[2-(methylsulfanylamino)-5-(trifluoromethyl)-3-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 10267859 |
| Molecular Formula | C12H10F3N3O2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-[2-(methylsulfanylamino)-5-(trifluoromethyl)-3-pyridinyl]furan-2-carboxamide |
| SMILES | CSNc1ncc(C(F)(F)F)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C12H10F3N3O2S/c1-21-18-10-8(5-7(6-16-10)12(13,14)15)17-11(19)9-3-2-4-20-9/h2-6H,1H3,(H,16,18)(H,17,19) |
| InChIKey | VZNAXOXAFPIZQX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|