C26H33N3O3 — CID 38100664
2-[[4-(azepan-1-ylmethyl)benzoyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 38100664) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[[4-(azepan-1-ylmethyl)benzoyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-[[4-(azepan-1-ylmethyl)benzoyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 38100664 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 2-[[4-(azepan-1-ylmethyl)benzoyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NC[C@@H]1CCCO1)c1ccc(CN2CCCCCC2)cc1 |
| InChI | InChI=1S/C26H33N3O3/c30-25(21-13-11-20(12-14-21)19-29-15-5-1-2-6-16-29)28-24-10-4-3-9-23(24)26(31)27-18-22-8-7-17-32-22/h3-4,9-14,22H,1-2,5-8,15-19H2,(H,27,31)(H,28,30)/t22-/m0/s1 |
| InChIKey | CGTRPLSMXWPINT-QFIPXVFZSA-N |
| XLogP | 4.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |