C22H20ClNO2S — CID 100763591
N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-4-methoxy-3-methylbenzamide (PubChem CID 100763591) has the molecular formula C22H20ClNO2S and a molecular weight of 397.93 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-4-methoxy-3-methylbenzamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-4-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 100763591 |
| Molecular Formula | C22H20ClNO2S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-4-methoxy-3-methylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2SCc2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C22H20ClNO2S/c1-15-13-17(9-12-20(15)26-2)22(25)24-19-5-3-4-6-21(19)27-14-16-7-10-18(23)11-8-16/h3-13H,14H2,1-2H3,(H,24,25) |
| InChIKey | FSPDANBWKZPHFG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |