C25H26ClNO2S — CID 133235547
4-[(4-chlorophenyl)sulfanylmethyl]-N-[1-(4-methoxy-3-methylphenyl)propyl]benzamide (PubChem CID 133235547) has the molecular formula C25H26ClNO2S and a molecular weight of 440.01 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfanylmethyl]-N-[1-(4-methoxy-3-methylphenyl)propyl]benzamide.
| Compound Name | 4-[(4-chlorophenyl)sulfanylmethyl]-N-[1-(4-methoxy-3-methylphenyl)propyl]benzamide |
|---|---|
| PubChem CID | 133235547 |
| Molecular Formula | C25H26ClNO2S |
| Molecular Weight | 440.01 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfanylmethyl]-N-[1-(4-methoxy-3-methylphenyl)propyl]benzamide |
| SMILES | CCC(NC(=O)c1ccc(CSc2ccc(Cl)cc2)cc1)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C25H26ClNO2S/c1-4-23(20-9-14-24(29-3)17(2)15-20)27-25(28)19-7-5-18(6-8-19)16-30-22-12-10-21(26)11-13-22/h5-15,23H,4,16H2,1-3H3,(H,27,28) |
| InChIKey | ZSXMPBSLCGKUSE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.01 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |