C27H21Cl2NO2S — CID 100749756
3-[(2-chlorophenyl)methoxy]-N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]benzamide (PubChem CID 100749756) has the molecular formula C27H21Cl2NO2S and a molecular weight of 494.44 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methoxy]-N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]benzamide.
| Compound Name | 3-[(2-chlorophenyl)methoxy]-N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]benzamide |
|---|---|
| PubChem CID | 100749756 |
| Molecular Formula | C27H21Cl2NO2S |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 3-[(2-chlorophenyl)methoxy]-N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1SCc1ccc(Cl)cc1)c1cccc(OCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C27H21Cl2NO2S/c28-22-14-12-19(13-15-22)18-33-26-11-4-3-10-25(26)30-27(31)20-7-5-8-23(16-20)32-17-21-6-1-2-9-24(21)29/h1-16H,17-18H2,(H,30,31) |
| InChIKey | JQBJJICCSIYMEZ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |