C28H24ClNO2 — CID 100749590
3-[(2-chlorophenyl)methoxy]-N-[(R)-(4-methylphenyl)-phenylmethyl]benzamide (PubChem CID 100749590) has the molecular formula C28H24ClNO2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methoxy]-N-[(R)-(4-methylphenyl)-phenylmethyl]benzamide.
| Compound Name | 3-[(2-chlorophenyl)methoxy]-N-[(R)-(4-methylphenyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 100749590 |
| Molecular Formula | C28H24ClNO2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3-[(2-chlorophenyl)methoxy]-N-[(R)-(4-methylphenyl)-phenylmethyl]benzamide |
| SMILES | Cc1ccc([C@H](NC(=O)c2cccc(OCc3ccccc3Cl)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24ClNO2/c1-20-14-16-22(17-15-20)27(21-8-3-2-4-9-21)30-28(31)23-11-7-12-25(18-23)32-19-24-10-5-6-13-26(24)29/h2-18,27H,19H2,1H3,(H,30,31)/t27-/m1/s1 |
| InChIKey | XUZQMYDFYWDDBS-HHHXNRCGSA-N |
| XLogP | 6.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |