C16H16ClNO2 — CID 13176467
3-[(2-chlorophenyl)methoxy]-N,N-dimethylbenzamide (PubChem CID 13176467) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methoxy]-N,N-dimethylbenzamide.
| Compound Name | 3-[(2-chlorophenyl)methoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 13176467 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-[(2-chlorophenyl)methoxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(OCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H16ClNO2/c1-18(2)16(19)12-7-5-8-14(10-12)20-11-13-6-3-4-9-15(13)17/h3-10H,11H2,1-2H3 |
| InChIKey | ALFWWHSXYARWRR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |