C23H22ClNO2 — CID 100750102
N-benzyl-3-[(2-chlorophenyl)methoxy]-N-ethylbenzamide (PubChem CID 100750102) has the molecular formula C23H22ClNO2 and a molecular weight of 379.89 g/mol. Its IUPAC name is N-benzyl-3-[(2-chlorophenyl)methoxy]-N-ethylbenzamide.
| Compound Name | N-benzyl-3-[(2-chlorophenyl)methoxy]-N-ethylbenzamide |
|---|---|
| PubChem CID | 100750102 |
| Molecular Formula | C23H22ClNO2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-benzyl-3-[(2-chlorophenyl)methoxy]-N-ethylbenzamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1cccc(OCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H22ClNO2/c1-2-25(16-18-9-4-3-5-10-18)23(26)19-12-8-13-21(15-19)27-17-20-11-6-7-14-22(20)24/h3-15H,2,16-17H2,1H3 |
| InChIKey | YKXJBEAKNMPHNG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |