C23H20Cl3NO2S — CID 100749292
3-[(2-chlorophenyl)methoxy]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 100749292) has the molecular formula C23H20Cl3NO2S and a molecular weight of 480.84 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methoxy]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 3-[(2-chlorophenyl)methoxy]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 100749292 |
| Molecular Formula | C23H20Cl3NO2S |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | 3-[(2-chlorophenyl)methoxy]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSCc1ccc(Cl)cc1Cl)c1cccc(OCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H20Cl3NO2S/c24-19-9-8-18(22(26)13-19)15-30-11-10-27-23(28)16-5-3-6-20(12-16)29-14-17-4-1-2-7-21(17)25/h1-9,12-13H,10-11,14-15H2,(H,27,28) |
| InChIKey | SIHBHQWWKPKAAM-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|