C16H15ClN2O2 — CID 70116493
4-chloro-1-N-(3,4-dimethylphenyl)benzene-1,2-dicarboxamide (PubChem CID 70116493) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 4-chloro-1-N-(3,4-dimethylphenyl)benzene-1,2-dicarboxamide.
| Compound Name | 4-chloro-1-N-(3,4-dimethylphenyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 70116493 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-chloro-1-N-(3,4-dimethylphenyl)benzene-1,2-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(Cl)cc2C(N)=O)cc1C |
| InChI | InChI=1S/C16H15ClN2O2/c1-9-3-5-12(7-10(9)2)19-16(21)13-6-4-11(17)8-14(13)15(18)20/h3-8H,1-2H3,(H2,18,20)(H,19,21) |
| InChIKey | IQVXCRWORHSBPJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |