C18H15BrN2O4S — CID 6133625
2-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]benzoic acid (PubChem CID 6133625) has the molecular formula C18H15BrN2O4S and a molecular weight of 435.30 g/mol. Its IUPAC name is 2-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 6133625 |
| Molecular Formula | C18H15BrN2O4S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 2-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]benzoic acid |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)NC(=S)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C18H15BrN2O4S/c1-25-15-8-7-12(19)10-11(15)6-9-16(22)21-18(26)20-14-5-3-2-4-13(14)17(23)24/h2-10H,1H3,(H,23,24)(H2,20,21,22,26)/b9-6+ |
| InChIKey | CAUUZYBQQVLAMA-RMKNXTFCSA-N |
| XLogP | 3.68 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|