C22H17Cl2N3O3S2 — CID 17115520
N-[4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]carbamothioylamino]-2-methoxyphenyl]thiophene-2-carboxamide (PubChem CID 17115520) has the molecular formula C22H17Cl2N3O3S2 and a molecular weight of 506.44 g/mol. Its IUPAC name is N-[4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]carbamothioylamino]-2-methoxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]carbamothioylamino]-2-methoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17115520 |
| Molecular Formula | C22H17Cl2N3O3S2 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | N-[4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]carbamothioylamino]-2-methoxyphenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(NC(=S)NC(=O)/C=C/c2ccc(Cl)cc2Cl)ccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C22H17Cl2N3O3S2/c1-30-18-12-15(7-8-17(18)26-21(29)19-3-2-10-32-19)25-22(31)27-20(28)9-5-13-4-6-14(23)11-16(13)24/h2-12H,1H3,(H,26,29)(H2,25,27,28,31)/b9-5+ |
| InChIKey | VQEAQPPEFZOKSZ-WEVVVXLNSA-N |
| XLogP | 5.84 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|